Pachymic acid is a triterpenoid compound that has been reported in Rhodofomitopsis lilacinogilva, Fomitopsis pinicola, and other organisms. It is isolated from the fungus Poria cocos and is known to inhibit phospholipase A2.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Pachymic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-chloro-4,6-diphenylpyrimidine
research compound for chemical synthesis
2,3,6-TRICHLOROPYRIDINE
chemical intermediate for research
2,9-DICHLORO-1,10-PHENANTHROLINE
Research reagent for coordination chemistry
1,2-Diaminobenzene (D4, 98%)
Deuterated internal standard for analytical chemistry
(2R)-2-[(3S,5R,10S,13R,14R,16R,17R)-3-acetyloxy-16-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid
VDYCLYGKCGVBHN-DRCQUEPLSA-N
CC(C)C(=C)CC[C@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)OC(=O)C)C)C)C)O)C(=O)O
Pachymic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.