3,5-Dichlorobenzoyl chloride is a chemical compound used as an intermediate in the synthesis of pharmaceutical intermediates. It features a benzene ring with three halogen substituents and a reactive acyl chloride group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2905-62-6
3-Pyridinecarboxamide, 1-ethyl-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-
Pharmaceutical intermediate
N-(2-Oxoethyl)phthalimide
Pharmaceutical intermediate for cyclopyrrolone drugs
(2S)-but-3-yn-2-ol
Chiral building block for synthesis
Fmoc-L-Lys[C20-OtBu-L-Glu(OtBu)-AA-AA]-OH
Pharmaceutical intermediate for peptide synthesis
3,5-dichlorobenzoyl chloride
GGHLXLVPNZMBQR-UHFFFAOYSA-N
C1=C(C=C(C=C1Cl)Cl)C(=O)Cl