This compound is a pharmaceutical intermediate used in the synthesis of NK1 receptor antagonists such as aprepitant. It features a complex stereochemically defined structure with aromatic rings, ether linkages, and halogen substituents, making it a key building block in manufacturing processes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 287930-75-0
Ethyl 8-(2,4-dioxo-2H-1,3-benzoxazin-3(4H)-yl)octanoate
Pharmaceutical intermediate for API synthesis
3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester
boronic ester pharmaceutical intermediate
Benzyl 4-(chlorosulfonyl)piperidine-1-carboxylate
Pharmaceutical intermediate for sulfonamide synthesis
BIRG-616 BS
Impurity reference standard for nevirapine
(2R)-4-benzyl-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]morpholin-3-one
KVPJNHLVRGUYGQ-BFUOFWGJSA-N
C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2C(=O)N(CCO2)CC3=CC=CC=C3