This compound is a pharmaceutical intermediate used in the synthesis of active pharmaceutical ingredients. It features a boron-containing heterocyclic structure, making it suitable for cross-coupling reactions in medicinal chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Carbobenzoxy-1,2,3,6-tetrahydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Pharmaceutical intermediate for drug synthesis
(S)-1-N-Cbz-Pipecolinic acid
Pharmaceutical intermediate for peptide synthesis
(2R)-1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
N-nitroso-desmethyl-minocycline-1
nitrosamine impurity reference standard
1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydropyridin-1(2H)-yl)ethan-1-one
Boronic ester protecting group reagent
1-Methyl-1,2,3,6-tetrahydropyridine-4-boronic acid, pinacol ester
boronic ester research reagent
4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1-(2,2,2-TRIFLUOROETHYL)-1,2,3,6-TETRAHYDROPYRIDINE
boronic ester pharmaceutical intermediate
tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate
VVDCRJGWILREQH-UHFFFAOYSA-N
B1(OC(C(O1)(C)C)(C)C)C2=CCN(CC2)C(=O)OC(C)(C)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.