Choline-1,1,2,2-d4 chloride is a stable isotope-labeled form of choline chloride, where four hydrogen atoms are replaced with deuterium. It is primarily used as a research reagent in metabolic and biochemical studies to trace choline pathways.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
CHOLINE-1,1,2,2-D4 CHLORIDE 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-AminoFluorene-D11
stable isotope labeled research reagent
Estrone-2,4,16,16-d4
stable isotope labeled research reagent
NONANOIC-D17 ACID
stable isotope labeled research reagent
Tert-Butyl (4-hydroxynaphthalen-1-yl)carbamate
research compound
4-(Dimethylamino)phenylboronic acid
research compound
5-BROMO-2-CHLOROPYRIDIN-3-OL
research compound
Ethyl 4,4-difluoro-2-[(oxiran-2-yl)methyl]butanoate
research compound
OXTRIPHYLLINE
active pharmaceutical ingredient
trimethyl-(1,1,2,2-tetradeuterio-2-hydroxyethyl)azanium chloride
SGMZJAMFUVOLNK-HGFPCDIYSA-M
[2H]C([2H])(C([2H])([2H])O)[N+](C)(C)C.[Cl-]
CHOLINE-1,1,2,2-D4 CHLORIDE 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.