This compound is a deuterium-labeled research reagent, specifically the hexadeuterated analog of 3-bromo-1-propanol. It is primarily used in scientific studies requiring isotopic labeling, such as metabolic or mechanistic investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-Bromo-1-propan-d6-ol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-BROMO-1-BUTANOL-1,1,2,2,3,3,4,4-D8
deuterated research compound
4-Hydroxybenzaldehyde-2,3,5,6-d4
deuterated reference standard for research
1,3-Propane-d6-diol
deuterated solvent or reagent
Ethyl-d5-amine hydrochloride
deuterated amine reference standard
DL-3-Hydroxytetradecanoic acid-2,2,3,4,4-d5
deuterated fatty acid research compound
3-Bromo-1-propanol
Chemical intermediate
3-bromo-1,1,2,2,3,3-hexadeuteriopropan-1-ol
RQFUZUMFPRMVDX-NMFSSPJFSA-N
[2H]C([2H])(C([2H])([2H])O)C([2H])([2H])Br
3-Bromo-1-propan-d6-ol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.