1,2,4,5-Cyclohexanetetracarboxylic dianhydride is a bicyclic anhydride compound primarily used as a monomer in the synthesis of polyimide polymers, which are valued for their thermal stability and mechanical properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2754-41-8
3-Oxabicyclo[3.1.0]hexane-2,4-dione
chemical intermediate in organic synthesis
3,3',4,4'-Biphenyltetracarboxylic dianhydride
monomer for polyimide synthesis
[4,5'-Biisobenzofuran]-1,1',3,3'-tetrone
monomer for polyimide synthesis
1,3-Bis(4-aminophenoxy)benzene
monomer for polyimide synthesis
Diisooctyl phthalate
Plasticizer for PVC and resins
1h,1h,2h,2h-perfluorooctanesulfonic acid
surfactant for industrial applications
5-Isoquinolinesulfonic acid
sulfonic acid intermediate
Butane-1,4-disulfonic acid
Industrial sulfonic acid reagent
3a,4,4a,7a,8,8a-hexahydrofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone
LJMPOXUWPWEILS-UHFFFAOYSA-N
C1C2C(CC3C1C(=O)OC3=O)C(=O)OC2=O