GSK215 is a research compound investigated for its role as a focal adhesion kinase (FAK) inhibitor. It is characterized by a large, complex molecular structure containing multiple aromatic rings, amide groups, and a trifluoromethyl substituent, which contribute to its use in laboratory studies of cellular signaling pathways.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2743427-26-9
4-Methoxybenzyl bromide
research reagent for organic synthesis
MAL-di-EG-Val-Cit-PAB-MMAE
antibody-drug conjugate linker payload
1-[bis(4-fluorophenyl)methyl]piperazine
research compound
1,1,1-Trichloroethane-2,2,2-d3
deuterated analytical reference standard
(2S,4R)-4-hydroxy-1-[(2S)-2-[[2-[4-[3-methoxy-4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)-2-pyridinyl]amino]phenyl]piperazin-1-yl]acetyl]amino]-3,3-dimethylbutanoyl]-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide
ZGSWGXNEXAXEGV-XFCHVEHOSA-N
CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CN4CCN(CC4)C5=CC(=C(C=C5)NC6=NC=C(C(=C6)NC7=CC=CC=C7C(=O)NC)C(F)(F)F)OC)O