Hydroxy dicyclopentadiene is a tricyclic alcohol compound used as an intermediate in pharmaceutical manufacturing. Its structure features a hydroxyl group attached to a tricyclodecene framework, and it is primarily supplied for research and production purposes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 27137-33-3
Ethyl (2Z)-2-chloro-2-[2-(4-methoxyphenyl)hydrazinylidene]acetate
pharmaceutical intermediate
3-Pyridazinecarboxylic acid, 6-chloro-4-[[2-methoxy-3-(1-methyl-1H-1,2,4-triazol-3-yl)phenyl]amino]-, methyl ester
pharmaceutical intermediate
5-{[(tert-butoxy)carbonyl]amino}pentanoic acid
pharmaceutical intermediate
3-(1-PIPERAZINYL)PROPIONIC ACID
pharmaceutical intermediate
(1S,2R,7R)-tricyclo[5.2.1.02,6]dec-4-en-3-ol
HRWRJUVJOLBMST-DJAYFPKFSA-N
C1C[C@@H]2C[C@H]1[C@@H]3C2C=CC3O