4-(2-Fluoro-4-nitrophenyl)morpholine is a chemical compound used as a pharmaceutical intermediate in research and manufacturing. It features a morpholine ring, a nitro group, and a fluorine atom on an aromatic scaffold, contributing to its reactivity and polarity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-(2-fluoro-4-nitrophenyl)morpholine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Thiophenecarboxylic acid, tetrahydro-4-oxo-, methyl ester
pharmaceutical intermediate
(R)-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-methylheptanoic acid
Fmoc-protected amino acid building block
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
Pharmaceutical intermediate for boronic acid derivatives
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
Pharmaceutical intermediate for boronic acid coupling
3-fluoro-4-morpholinoaniline
pharmaceutical intermediate
(3-Morpholinophenyl)boronic acid hydrochloride
research compound
4-Morpholinoaniline
research compound
4-(2-fluoro-4-nitrophenyl)morpholine
ZEQCFSSBZPZEFJ-UHFFFAOYSA-N
C1COCCN1C2=C(C=C(C=C2)[N+](=O)[O-])F
4-(2-fluoro-4-nitrophenyl)morpholine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.