4,4'-Thiodiphenol is an organic compound that serves as an intermediate in polymer synthesis. Its structure features two aromatic rings linked by a sulfur atom, with hydroxyl groups that contribute to hydrogen-bonding networks in the solid state.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4,4'-Thiodiphenol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Vinyl isononanoate
monomer for polymerization reactions
Furan-2,5-dione;prop-2-enoic acid
polymer intermediate
3,9-bis(2,4-di-tert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane
antioxidant polymer stabilizer
Butyl perneodecanoate
organic peroxide polymerization initiator
2-[(2,4-Dimethylphenyl)sulfanyl]aniline
pharmaceutical intermediate
Bis(4-methacryloylthiophenyl) Sulfide
crosslinking monomer for polymers
2-((2-Fluorophenyl)thio)-5-(methylsulfonyl)aniline
research compound
2-(2-((4-Chlorophenyl)thio)phenyl)acetic acid
n.a
4,4'-Thiodiphenol(CAS 2664-63-3)의 국제 HS 코드는 2930.90입니다.
2930.90
2930 90 95
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
4-(4-hydroxyphenyl)sulfanylphenol
VWGKEVWFBOUAND-UHFFFAOYSA-N
C1=CC(=CC=C1O)SC2=CC=C(C=C2)O
4,4'-Thiodiphenol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.