This compound is a fluorinated heterocyclic research reagent featuring a fused furo-chromenone core with stereochemically defined methyl and trifluoromethyl substituents. Its structure includes multiple aromatic rings and halogen atoms, contributing to its potential utility in chemical biology and medicinal chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Propyltrimethylammonium bromide
Phase transfer catalyst
Carbonotrithioic acid, bis(phenylmethyl) ester
research compound for RAFT polymerization
(R)-2-(tert-Butyl-dimethyl-silanyloxy)-propan-1-ol
research reagent
2,3-Dihydroxy-N~1~,N~1~,N~4~,N~4~-tetramethylbutanediamide
reference standard for research
(1S,2R)-6,7-difluoro-1,2-dimethyl-2-(trifluoromethyl)-1H-furo[2,3-c]chromen-4-one
HVWSPQLRNJXDCB-VPROBKIXSA-N
C[C@H]1C2=C(C(=O)OC3=C2C=CC(=C3F)F)O[C@@]1(C)C(F)(F)F
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.