This compound is a fluorinated heterocyclic research reagent featuring a fused furo-chromenone core with stereochemically defined methyl and trifluoromethyl substituents. Its structure includes multiple aromatic rings and halogen atoms, contributing to its potential utility in chemical biology and medicinal chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2649470-79-9
Propyltrimethylammonium bromide
Phase transfer catalyst
Carbonotrithioic acid, bis(phenylmethyl) ester
research compound for RAFT polymerization
(R)-2-(tert-Butyl-dimethyl-silanyloxy)-propan-1-ol
research reagent
2,3-Dihydroxy-N~1~,N~1~,N~4~,N~4~-tetramethylbutanediamide
reference standard for research
(1S,2R)-6,7-difluoro-1,2-dimethyl-2-(trifluoromethyl)-1H-furo[2,3-c]chromen-4-one
HVWSPQLRNJXDCB-VPROBKIXSA-N
C[C@H]1C2=C(C(=O)OC3=C2C=CC(=C3F)F)O[C@@]1(C)C(F)(F)F
—