This compound is a deuterated form of 1,4-naphthoquinone, where the six ring hydrogen atoms are replaced with deuterium. It is commonly used as a research standard in analytical chemistry for tracing and quantification studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,4-naphthoquinone-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,2,3,3,3-pentadeuterio-1-(2,3,4,5,6-pentadeuteriophenyl)propan-1-one
Deuterated research standard
1,10-DECANE-D20-DIOL
Deuterated research standard
2-Bromopropane-d7
Deuterated research standard
(+/-)-Carazolol-d7 HCl (iso-propyl-d7)
Deuterated research standard
(9H-fluoren-9-yl)methyl ((6S,9S)-1-amino-6-((4-(hydroxymethyl)phenyl)carbamoyl)-9-isopropyl-1,8,11,14,17-pentaoxo-2,7,10,13,16-pentaazaoctadecan-18-yl)carbamate
research compound for drug delivery
(9H-Fluoren-9-yl)methyl ((6S,9S)-1-amino-9-isopropyl-6-((4-((((4-nitrophenoxy)carbonyl)oxy)methyl)phenyl)carbamoyl)-1,8,11,14,17-pentaoxo-2,7,10,13,16-pentaazaoctadecan-18-yl)carbamate
research compound
5-(Trifluoromethyl)-5H-thianthren-5-ium trifluoromethanesulfonate
research compound
Ethyl (4R,5R)-4,5-dimethyl-5-(trifluoromethyl)-3-(((trifluoromethyl)sulfonyl)oxy)-4,5-dihydrofuran-2-carboxylate
research compound
2,3,5,6,7,8-hexadeuterionaphthalene-1,4-dione
FRASJONUBLZVQX-MZWXYZOWSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=O)C(=C(C2=O)[2H])[2H])[2H])[2H]
1,4-naphthoquinone-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.