N-Nitroso-Folic Acid is a nitrosamine derivative of folic acid, primarily used as a reference standard for the detection and quantification of nitrosamine impurities in pharmaceutical manufacturing. This compound features a complex polycyclic structure incorporating multiple aromatic rings and polar functional groups, reflecting its role as a specialized analytical marker.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 26360-21-4
5-Desethoxy,-5-Methoxy-Finerenone
Mineralocorticoid receptor antagonist intermediate
1-(3,4-Dihydroxyphenyl)-2-(methylamino)ethane-1-sulfonic acid
active pharmaceutical ingredient
Acalabrutinib maleate monohydrate
active pharmaceutical ingredient
Sodium chenodeoxycholate
pharmaceutical active ingredient
Folic acid
Vitamin nutritional factor
Folic acid dihydrate
active pharmaceutical ingredient
N-Nitrosofolic acid
nitrosamine impurity standard for folic acid
N2-(4-(((2-Amino-4-oxo-4,8-dihydropteridin-6-yl)methyl)amino)benzoyl)-N5-(2-(2-(2-azidoethoxy)ethoxy)ethyl)-L-glutamine
PEGylated folate probe for click chemistry
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-nitrosoamino]benzoyl]amino]pentanedioic acid
QPWWRIJXAKSKLU-LBPRGKRZSA-N
C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)N(CC2=CN=C3C(=N2)C(=O)NC(=N3)N)N=O