This compound is a protected proline derivative used as an intermediate in peptide synthesis. Its structure features a tert-butoxycarbonyl (Boc) protecting group on the nitrogen and a free carboxylic acid, making it valuable for solid-phase and solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 26250-84-0
(2R)-1-[(tert-butoxy)carbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid for peptide synthesis
Boc-L-proline
Protected amino acid for peptide synthesis
(S)-(-)-1-Phenylethylamine
Chiral resolution intermediate
3-Iodooxetane
pharmaceutical intermediate
(2S)-1-amino-1-oxo-3-((3S)-2-oxopyrrolidin-3-yl)propan-2-aminium chloride
pharmaceutical intermediate
2-Amino-2,3-dimethylbutanoic acid
Pharmaceutical intermediate for amino acid derivatives
(2R)-1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Boc-protected piperidine carboxylic acid intermediate
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid
JQAOHGMPAAWWQO-QMMMGPOBSA-N
CC(C)(C)OC(=O)N1CCCC[C@H]1C(=O)O