This compound is an azo compound used as a polymerization initiator in industrial chemical processes. It features two ester and two ether functional groups, contributing to its role in initiating free-radical polymerizations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2589-57-3
Tert-butyl 2-ethylhexaneperoxoate
polymerization initiator
Tert-Butyl peroxypivalate
polymerization initiator
Peroxydicarbonic acid, bis(2-ethylhexyl) ester
polymerization initiator
1,1-Bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane
polymerization initiator
2-Pentenenitrile, (Z)-
chemical intermediate
2-(2H-Benzotriazol-2-yl)-4,6-ditertpentylphenol
UV absorber for plastics
Gamma-Glycidoxypropyltriethoxysilane
silane coupling agent
Hydrochloric acid
acid cleaning and metal processing
methyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanoate
ZQMHJBXHRFJKOT-UHFFFAOYSA-N
CC(C)(C(=O)OC)N=NC(C)(C)C(=O)OC