3-(Trimethoxysilyl)propyl methacrylate is a silane coupling agent commonly used to improve adhesion between organic polymers and inorganic substrates. Its molecular structure combines a methacrylate group for polymer bonding with trimethoxysilyl groups for surface attachment, making it valuable in adhesive formulations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2530-85-0
3-Chloropropyltrimethoxysilane
Coupling agent for filled composites
Sodium O-isobutyl dithiocarbonate
flotation collector agent
Benzyltributylammonium bromide
Phase transfer catalyst
25322-68-3
polymer and surfactant raw material
3-trimethoxysilylpropyl 2-methylprop-2-enoate
XDLMVUHYZWKMMD-UHFFFAOYSA-N
CC(=C)C(=O)OCCC[Si](OC)(OC)OC