Nitroso-L-arginine is a nitrosamine derivative of the amino acid arginine. It is primarily used as a reference standard for analytical testing and research into nitrosamine impurities.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2492451-27-9
N-Nitroso n-Methyl-3-phenylpropan-1-amine
nitrosamine reference standard
N-nitroso-desmethyl-orphenadrine
nitrosamine reference standard
N-Nitroso Betahistine
nitrosamine reference standard
Alverine Impurity 19
nitrosamine reference standard
2-Chloro-3,5-dinitrobenzoic acid
arylating agent
(2-bromophenyl)methanesulfonyl Chloride
research compound
4-Aminobenzamidine dihydrochloride
research compound
8-CHLORO-2-METHOXY-1,5-NAPHTHYRIDINE
research compound
(2S)-5-(diaminomethylideneamino)-2-(2-oxohydrazinyl)pentanoic acid
JJWNDJPMAQXKDS-BYPYZUCNSA-N
C(C[C@@H](C(=O)O)NN=O)CN=C(N)N