This compound is a hydrochloride salt of S-tert-butyl-L-cysteine, a derivative of the amino acid cysteine. It is primarily used as a research reagent in laboratory settings, particularly in studies involving modified amino acids for peptide synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2481-09-6
Trimethyl orthopropionate
chemical reagent and intermediate
FMOC-PRO-THR(PSI(ME,ME)PRO)-OH
research compound for peptide synthesis
(2S)-2,6-Bis({[(Tert-Butoxy)Carbonyl]Amino})Hexanoic Acid
protected lysine derivative for peptide synthesis
D-Allothreonine
D-alpha-amino acid standard
(2R)-2-amino-3-tert-butylsulfanylpropanoic acid;hydrochloride
MHBMYFJKEBCMDR-JEDNCBNOSA-N
CC(C)(C)SC[C@@H](C(=O)O)N.Cl