9H-Pyrido[2,3-b]indole is a research compound classified by the International Agency for Research on Cancer (IARC) as possibly carcinogenic to humans (Group 2B), based on limited evidence in humans and sufficient evidence in experimental animals. It is a tricyclic heterocyclic compound used primarily as a laboratory reagent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 244-76-8
(2-bromophenyl)boronic Acid
research reagent for organic synthesis
5-Chloro-2-iodopyridine
research compound
Di-tert-butyl dicarbonate
Reagent for amine Boc protection
4,4'-Bi-1,3-benzodioxole-5,5'-diylbis(diphenylphosphine)
chiral ligand for asymmetric catalysis
9H-pyrido[2,3-b]indole
BPMFPOGUJAAYHL-UHFFFAOYSA-N
C1=CC=C2C(=C1)C3=C(N2)N=CC=C3