Benzenesulfinic acid, zinc salt is a chemical compound used as a sulfinate reagent in organic synthesis. It serves as a source of the benzenesulfinate anion in various chemical reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 24308-84-7
Benzenesulfinic acid sodium salt
preservative and antioxidant intermediate
1,1,2-Trimethoxyethane
chemical intermediate
Benzenesulfinic acid, 4-methyl-, zinc salt
zinc salt of p-toluenesulfinic acid
Lithium difluorophosphate (LiPO2F2 /LiDFP)
battery electrolyte additive
2-(DIMETHYLAMINO)ETHYL ACRYLATE
acrylic monomer for copolymer production
zinc benzenesulfinate
UMGLWJIVIBWZCW-UHFFFAOYSA-L
C1=CC=C(C=C1)S(=O)[O-].C1=CC=C(C=C1)S(=O)[O-].[Zn+2]