N-tert-butoxycarbonyl-L-glutamic acid tert-butyl ester is a protected derivative of L-glutamic acid used as a pharmaceutical intermediate. It features both Boc and tert-butyl ester protecting groups, making it suitable for peptide synthesis in research and manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-(tert-Butoxycarbonyl)-L-glutamic Acid 1-tert-Butyl Ester 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(4S)-4-{[(tert-butoxy)carbonyl]amino}-5-methoxy-5-oxopentanoic acid
pharmaceutical intermediate for peptide synthesis
(2S)-2-{[(tert-butoxy)carbonyl]amino}pentanedioic acid
Peptide synthesis intermediate
(S)-1-tert-Butyl 5-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate
research compound
4-Amino-3,5-dichlorobenzotrifluoride
pharmaceutical intermediate
3,4,5-TRIMETHOXYANILINE
Pharmaceutical intermediate
2,4,5-Trifluorobenzyl chloride
Pharmaceutical intermediate
6-Amino-1-methyluracil
Pharmaceutical intermediate
(4R)-5-(tert-butoxy)-4-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
peptide synthesis intermediate
(4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid
YMOYURYWGUWMFM-VIFPVBQESA-N
CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OC(C)(C)C
N-(tert-Butoxycarbonyl)-L-glutamic Acid 1-tert-Butyl Ester 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.