Ifosfamide impurity B is a chemical compound used as a pharmaceutical intermediate. It is a polar, flexible molecule containing amine and halogen functional groups, and is relevant to the manufacturing of pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 241482-18-8
1H-Imidazole-1-ethanol, alpha-(2,4-dichlorophenyl)-
pharmaceutical intermediate
Tert-butyl (4s)-4-amino-3,3-difluoropiperidine-1-carboxylate
pharmaceutical intermediate
6,6-Dibromopenicillanic acid
Penicillin intermediate for antibiotic synthesis
Tert-Butyl (S)-(1-(3-(3-chloro-4-cyanophenyl)-1H-pyrazol-1-yl)propan-2-yl)carbamate
Pharmaceutical intermediate
[3-(2-chloroethylamino)propoxy-hydroxyphosphoryl] 3-(2-chloroethylamino)propyl hydrogen phosphate
MXHIKWVFLYAVGY-UHFFFAOYSA-N
C(CNCCCl)COP(=O)(O)OP(=O)(O)OCCCNCCCl