2-Bromo-1-[4-(2,6-difluorophenoxy)phenyl]ethanone is a brominated difluorophenoxyphenyl ketone compound used primarily as a chemical intermediate in organic synthesis. Its structure features two aromatic rings, an ether linkage, and a halogenated ketone moiety, making it suitable for constructing more complex molecules in research and laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2410975-52-7
N-Biotinyl Dopamine
research compound for biotinylation studies
9-(4,18-ditert-butyl-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-yl)-3,6-bis(9-phenylcarbazol-3-yl)carbazole
organic semiconductor research compound
AST5902 mesylate
research compound for tyrosine kinase
Acalabrutinib Impurity 21
pharmaceutical impurity reference standard
2-bromo-1-[4-(2,6-difluorophenoxy)phenyl]ethanone
GEBMDWUJIRFTKK-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)OC2=CC=C(C=C2)C(=O)CBr)F
—