This compound is a pharmaceutical active ingredient featuring a complex structure with an amide linkage, a carboxylic acid group, and a tetrahydro-1,8-naphthyridine ring system. It is primarily supplied as a chemical intermediate or research compound for pharmaceutical development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2408065-32-5
N-Benzyl albuterol
active pharmaceutical ingredient
7-Ketoabiraterone acetate
pharmaceutical impurity reference standard
FLUPENTIXOL DIHYDROCHLORIDE
Active pharmaceutical ingredient for schizophrenia
(S)-N4-(4-Fluorophenyl)-7-((tetrahydrofuran-3-yl)oxy)quinazoline-4,6-diamine (Afatinib Impurity)
Afatinib impurity reference standard
(2S)-2-[(4-methyloxane-4-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid
GELVLHVQVRSFAY-FQEVSTJZSA-N
CC1(CCOCC1)C(=O)N[C@@H](CCCCCCCC2=NC3=C(CCCN3)C=C2)C(=O)O