Eritadenine is a chemical compound found in shiitake mushrooms that acts as an inhibitor of S-adenosyl-L-homocysteine hydrolase (SAHH). It is primarily known for its hypocholesterolemic activity in research settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 23918-98-1
3-(4-Aminophenyl)propionic acid
Research reagent for biochemical studies
4-Methoxybenzylamine
Research compound
Ethyl 4-(2,2,2-trifluoroethoxy)-1H-pyrazole-3-carboxylate
research compound
T-boc-N-amido-PEG11-azide
PEG-linked azide coupling reagent
(2R,3R)-4-(6-aminopurin-9-yl)-2,3-dihydroxybutanoic acid
LIEMBEWXEZJEEZ-INEUFUBQSA-N
C1=NC(=C2C(=N1)N(C=N2)C[C@H]([C@H](C(=O)O)O)O)N