2-Phenyl-9H-carbazole-d5 is a deuterated derivative of 2-phenyl-9H-carbazole, where the hydrogen atoms on the phenyl ring are replaced with deuterium. It is primarily used as an isotopic internal standard or reference standard in analytical research, particularly in mass spectrometry and chromatography.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2375066-12-7
4-Hydroxybenzaldehyde-2,3,5,6-d4
deuterated reference standard for research
(2H5)Glycine
deuterated reference standard for research
Methyl 2-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-oxoacetate
research compound
4-(Chlorodifluoromethyl)-2-fluoropyridine
research compound
Azido-PEG24-NHS ester
PEGylated bioconjugation reagent
(S)-1-Benzyl-3,3-difluoropiperidin-4-ol
research compound
2-(2,3,4,5,6-pentadeuteriophenyl)-9H-carbazole
IMLDYQBWZHPGJA-FSTBWYLISA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC3=C(C=C2)C4=CC=CC=C4N3)[2H])[2H]