2-Phenyl-9H-carbazole-d5 is a deuterated derivative of 2-phenyl-9H-carbazole, where the hydrogen atoms on the phenyl ring are replaced with deuterium. It is primarily used as an isotopic internal standard or reference standard in analytical research, particularly in mass spectrometry and chromatography.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Phenyl-9H-carbazole-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Hydroxybenzaldehyde-2,3,5,6-d4
deuterated reference standard for research
(2H5)Glycine
deuterated reference standard for research
Methyl 2-(2-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-oxoacetate
research compound
4-(Chlorodifluoromethyl)-2-fluoropyridine
research compound
Azido-PEG24-NHS ester
PEGylated bioconjugation reagent
(S)-1-Benzyl-3,3-difluoropiperidin-4-ol
research compound
2-(2,3,4,5,6-pentadeuteriophenyl)-9H-carbazole
IMLDYQBWZHPGJA-FSTBWYLISA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC3=C(C=C2)C4=CC=CC=C4N3)[2H])[2H]
2-Phenyl-9H-carbazole-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.