This compound is an industrial chemical primarily used as a processing aid in manufacturing operations. It features a complex aromatic structure with sulfonamide and carbamate functional groups, contributing to its role in industrial applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 232938-43-1
2-Propanol, 1,3-bis((3-methyl-2-buten-1-yl)oxy)-
intermediate for chemical synthesis
Methyl 2-bromo-2-methylpropanoate
Chemical intermediate for synthesis
Methyl 2-fluoroacrylate
Monomer for polymer synthesis
2-(4-bromophenyl)-4,6-diphenyl-1,3,5-triazine
Electronic material intermediate
[3-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl] 4-methylbenzenesulfonate
HEVGMYPGMWZOBU-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=CC(=CC=C2)OS(=O)(=O)C3=CC=C(C=C3)C