2-Bromo-3-methyl-5-nitropyridine is a chemical compound featuring a pyridine ring substituted with bromine, methyl, and nitro groups. It is primarily used as an intermediate in the synthesis of other chemical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Bromo-3-methyl-5-nitropyridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Propyl-4-piperidone
pharmaceutical intermediate for piperidine derivatives
5-(Carbobenzoxyamino)valeric Acid
Pharmaceutical intermediate for peptide synthesis
8-Chloro-1-octanol
pharmaceutical intermediate
7-(2-Bromoethyl)-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione
pharmaceutical intermediate
2-bromo-3-methyl-5-nitropyridine
FZIQHPKXSLHGBZ-UHFFFAOYSA-N
CC1=CC(=CN=C1Br)[N+](=O)[O-]
2-Bromo-3-methyl-5-nitropyridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.