Taltobulin is a small molecule active pharmaceutical ingredient. It is a synthetic analog of the tripeptide hemiasterlin and has a monoisotopic molecular weight of 473.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 228266-40-8
Miconazole nitrate
antifungal active pharmaceutical ingredient
Lenacapavir sodium
active pharmaceutical ingredient
Anisomycin
antibiotic protein synthesis inhibitor
5-{2-oxo-hexahydro-1H-thieno[3,4-d]imidazolidin-4-yl}pentanoic acid
active pharmaceutical ingredient
(E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid
CNTMOLDWXSVYKD-PSRNMDMQSA-N
CC(C)[C@@H](/C=C(\C)/C(=O)O)N(C)C(=O)[C@H](C(C)(C)C)NC(=O)[C@H](C(C)(C)C1=CC=CC=C1)NC