Tetradeutero-1,2-dibromoethane is a deuterated analog of 1,2-dibromoethane used primarily as an analytical reference standard. Its structure incorporates four deuterium atoms, enabling precise quantification in mass spectrometry and nuclear magnetic resonance spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 22581-63-1
(2H10)Benzophenone
Deuterated internal standard for analysis
Tert-butylmagnesium bromide
organomagnesium reagent for synthesis
SC-VC-PAB-MMAE
antibody-drug conjugate research compound
(2E)-3-[1-[[3,5-Bis(trifluoromethyl)phenyl]methyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-cyano-2-propenoic acid
research compound
1,2-Dibromoethane
fumigant and gasoline additive
1,2-dibromo-1,1,2,2-tetradeuterioethane
PAAZPARNPHGIKF-LNLMKGTHSA-N
[2H]C([2H])(C([2H])([2H])Br)Br