2-Bromo-6-fluorobenzoic acid is an organic compound featuring a benzene ring substituted with bromine and fluorine atoms, along with a carboxylic acid group. It serves as a research reagent, primarily utilized in laboratory settings for chemical synthesis and experimental studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2252-37-1
2-bromo-6-fluorobenzoic acid
MDAZJVAIZVUWDE-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Br)C(=O)O)F