This compound is a chemical intermediate used in the manufacturing of vardenafil, a pharmaceutical ingredient. It features a complex heterocyclic structure with aromatic rings and an ether functional group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 224789-21-3
2-(2-ethoxyphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one
YRRWQMBIMZMVDB-UHFFFAOYSA-N
CCCC1=NC(=C2N1N=C(NC2=O)C3=CC=CC=C3OCC)C