This compound is a deuterated form of 1,4-benzoquinone, where all four hydrogen atoms on the ring are replaced with deuterium. It is primarily used as a research reagent in scientific studies requiring isotopic labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,5-Cyclohexadiene-1,4-dione-2,3,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Mometasone Furoate EP Impurity B
Analytical reference standard impurity
(2S)-N-[(2S)-1-[4-[(6aS)-3-[3-[[(6aS)-2-methoxy-8-(4-methoxyphenyl)-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]propoxy]-2-methoxy-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-8-yl]anilino]-1-oxopropan-2-yl]-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-methylbutanamide
antibody-drug conjugate linker payload
2-Chloro(phenyl-3,4,5,6-d4)-boronic acid
deuterated chemical research reagent
2,2'-Anhydro-athy
UPase inhibitor research compound
P-benzoquinone
chemical intermediate and oxidizing agent
조효소 Q10
active pharmaceutical ingredient
Idebenone
Active pharmaceutical ingredient
Trimethylquinone
Quinone intermediate for synthesis
2,3,5,6-tetradeuteriocyclohexa-2,5-diene-1,4-dione
AZQWKYJCGOJGHM-RHQRLBAQSA-N
[2H]C1=C(C(=O)C(=C(C1=O)[2H])[2H])[2H]
2,5-Cyclohexadiene-1,4-dione-2,3,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.