2-Bromo-5-(4-cyanophenoxy)benzyl acetate is a chemical compound used as a pharmaceutical intermediate. It features an aromatic core with ester, ether, halogen, and nitrile functional groups, contributing to its role in synthetic chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2227126-09-0
Methyl 4-[(1S)-1-aminoethyl]benzoate
pharmaceutical intermediate
(R)-7,8-Difluoro-6,11-dihydrodibenzo[b,e]thiepin-11-ol
Pharmaceutical intermediate for synthesis
(S)-7,8-difluoro-6,11-dihydrodibenzo[b,e]thiepin-11-ol
pharmaceutical intermediate
Methyl 1-[3-fluoro-4-(methylcarbamoyl)anilino]cyclobutane-1-carboxylate
pharmaceutical intermediate for apalutamide
[2-bromo-5-(4-cyanophenoxy)phenyl]methyl acetate
LESJMARECHWSBI-UHFFFAOYSA-N
CC(=O)OCC1=C(C=CC(=C1)OC2=CC=C(C=C2)C#N)Br