This compound is a research reagent with a complex polycyclic structure featuring multiple aromatic rings, ester and ether linkages, and a difluorinated side chain. It is primarily used in laboratory settings for chemical and pharmaceutical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2S,4R)-N-(2,6-DIMETHYLPHENYL)-4-HYDROXYPYRROLIDINE-2-CARBOXAMIDE
research compound
6-Chloro-2-methyl-3-nitropyridine
research compound
6-methyl-5-nitropyridin-2-amine
Pharmaceutical intermediate research compound
1,1-Dichloroethene-d2
deuterated chemical reference standard
[(3aR,4R,5R,6aS)-4-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate
YPWLURRSSKUPIX-STPUXQIESA-N
C1[C@H]2[C@H](CC(=O)O2)[C@H]([C@@H]1OC(=O)C3=CC=C(C=C3)C4=CC=CC=C4)/C=C/C(COC5=CC=CC=C5)(F)F
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.