MAC glucuronide linker-1 is a research reagent designed as a linker compound for conjugation applications. Its structure features a glucuronide moiety with multiple acetyl groups and a fluorenylmethoxycarbonyl (Fmoc) protected amine, contributing to its high molecular weight and flexibility.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2222981-71-5
(S)-N-(4-((3-Chloro-4-fluorophenyl)amino)-7-((tetrahydrofuran-3-yl)oxy)quinazolin-6-yl)formamide (Afatinib Impurity)
research impurity reference standard
4-Ethoxyphenylboronic acid
Research intermediate for organic synthesis
7-methoxy-2,3,4,5-tetrahydro-1H-1-benzazepin-2-one
Research compound
(1H-Indol-3-yl)methanamine
Research compound
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetyl]amino]-4-(2-methylsulfonylethylcarbamoyloxymethyl)phenoxy]oxane-2-carboxylate
HKCMXFVQNGHVML-KWMSUFDQSA-N
CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC2=C(C=C(C=C2)COC(=O)NCCS(=O)(=O)C)NC(=O)CN(C)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)OC)OC(=O)C