나프록센
(S)-Naproxen is the single-enantiomer active pharmaceutical ingredient of the common nonsteroidal anti-inflammatory drug naproxen. Its structure features a carboxylic acid group, an aromatic ring system, and an ether moiety, with a molecular weight of 230.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 22204-53-1
(3R,6E)-7-(2-Cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl)-3-hydroxy-5-oxo-6-heptenoic acid
statin metabolite impurity
Carbimazole
antithyroid agent
(E)-N-(4-((3-Chloro-4-fluorophenyl)amino)-7-hydroxyquinazolin-6-yl)-4-(dimethylamino)but-2-enamide
active pharmaceutical ingredient
(S,E)-N-(4-((3,4-Difluorophenyl)amino)-7-((tetrahydrofuran-3-yl)oxy)quinazolin-6-yl)-4-(dimethylamino)but-2-enamide (Afatinib Impurity)
Afatinib impurity reference standard
2-(6-Methoxy-2-naphthyl)propionic acid
active pharmaceutical ingredient
Naproxen sodium
non-steroidal anti-inflammatory drug
Rac Naproxen-d3
Deuterated active pharmaceutical ingredient
(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid
CMWTZPSULFXXJA-VIFPVBQESA-N
C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O