2-Bromo-5-chlorobenzoic acid is a chemical compound commonly employed as a pharmaceutical intermediate. It features a substituted benzoic acid structure with two halogen atoms, making it useful in the synthesis of active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 21739-93-5
Pregnenolone-16-ene acetate oxime
pharmaceutical intermediate for abiraterone
5-Bromo-2-iodobenzoic acid
Pharmaceutical intermediate
1-(Chloromethyl)-2-(trifluoromethyl)benzene
organic synthesis intermediate
Tert-butyl N-(azetidin-3-yl)carbamate hydrochloride
pharmaceutical intermediate for API synthesis
2-bromo-5-chlorobenzoic acid
RBCPJQQJBAQSOU-UHFFFAOYSA-N
C1=CC(=C(C=C1Cl)C(=O)O)Br