1-Acryloyloxy-3-hydroxyadamantane is a chemical compound identified as a pharmaceutical intermediate, featuring both an acrylate ester and a hydroxyl group attached to an adamantane core. Its significance lies in its role as a building block for the synthesis of more complex pharmaceutical agents.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 216581-76-9
(R)-tert-Butyl oxirane-2-carboxylate
Pharmaceutical intermediate for synthesis
Tert-Butyl (4R)-3,3-difluoro-4-hydroxypyrrolidine-1-carboxylate
pharmaceutical intermediate
Tert-Butyl N-[(3R)-4,4-difluoropyrrolidin-3-yl]carbamate
pharmaceutical intermediate
Tert-Butyl N-[(3S)-4,4-difluoropyrrolidin-3-yl]carbamate
Boc-protected chiral amine intermediate
(3-hydroxy-1-adamantyl) prop-2-enoate
DKDKCSYKDZNMMA-UHFFFAOYSA-N
C=CC(=O)OC12CC3CC(C1)CC(C3)(C2)O