Hexafluoroisopropyl acrylate is a fluorinated acrylate monomer used in the synthesis of specialty polymers and coatings. Its structure contains an ester group and multiple fluorine atoms, contributing to properties such as chemical resistance and thermal stability.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Hexafluoroisopropyl acrylate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tert-Butyldiethanolamine
Chemical intermediate for surfactants and corrosion inhibitors
1,8-Dichlorooctane
intermediate for organic synthesis
1,6-DICHLOROHEXANE
chemical intermediate and monomer
2-Methyl-1,3-propanediol
solvent and resin intermediate
Hexafluoroisopropyl acrylate(CAS 2160-89-6)의 국제 HS 코드는 2916.12입니다.
2916.12
2916 12 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,1,1,3,3,3-hexafluoropropan-2-yl prop-2-enoate
MNSWITGNWZSAMC-UHFFFAOYSA-N
C=CC(=O)OC(C(F)(F)F)C(F)(F)F
Hexafluoroisopropyl acrylate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.