Methyl 3,5-dimethoxybenzoate is a chemical compound characterized by an aromatic ring bearing ester and ether functional groups. It is primarily significant as an intermediate in the synthesis of other chemical products.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2150-37-0
3-(2,3-dihydrobenzo[b]furan-5-yl)propanoic acid
Pharmaceutical intermediate
5-Chloro-2-furaldehyde
Pharmaceutical intermediate for synthesis
8-Bromo-6-methylquinazolin-4(3H)-one
pharmaceutical intermediate
4-Aminomethyl-pyrrolidin-3-one-methyloxime 2HCl
Pharmaceutical intermediate building block
methyl 3,5-dimethoxybenzoate
YXUIOVUOFQKWDM-UHFFFAOYSA-N
COC1=CC(=CC(=C1)C(=O)OC)OC