This compound is an organoboron compound containing a nitrile group and a dioxaborolane ring. It is primarily used as a chemical intermediate in organic synthesis and materials research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-(2-Cyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
SKQNWSBNAIOCOC-UHFFFAOYSA-N
B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C#N
2-(2-Cyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.