2-Methyl-5-nitropyridine is a nitrogen-containing heterocyclic aromatic compound featuring a pyridine ring substituted with a methyl group and a nitro group. It is commonly utilized as an intermediate in the synthesis of various pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 21203-68-9
Afatinib impurity 12
Afatinib impurity reference standard
N-[3-Amino-4-(methylamino)benzoyl]-N-2-pyridinyl-Beta-alanine Ethyl Ester
pharmaceutical intermediate
B-(4-Ethoxy-2,3-difluorophenyl)boronic acid
Pharmaceutical intermediate
2-(3-(4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)-1H-pyrazol-1-yl)-1-(ethylsulfonyl)azetidin-3-yl)acetonitrile
pharmaceutical intermediate
2-methyl-5-nitropyridine
USZINSZJSVMICC-UHFFFAOYSA-N
CC1=NC=C(C=C1)[N+](=O)[O-]