1,2-Cyclohexane-d10-diamine (cis/trans mixture) is a deuterated research reagent, specifically a decadeuterated cyclohexane-1,2-diamine. Its significance lies in its use as a labeled compound for analytical and research applications, where the incorporation of deuterium atoms allows for tracing and mechanistic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,2-Cyclohexane-d10-diamine (cis/trans mixture) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-bromo-6-nitropyridine
Research reagent
Methyl (2S)-2-hydroxy-2-phenylacetate
chiral synthetic reagent
Di(1H-pyrrol-2-yl)methane
research compound
1-(1-(4-(chloromethyl)phenyl)ethoxy)-2,2,6,6-tetramethylpiperidine
research compound
(1S,2S)-(+)-1,2-Diaminocyclohexane
building block for asymmetric catalysis
Xaliplatin
active pharmaceutical ingredient
Cis-1,2-Diaminocyclohexane
research chemical
(1R,2R)-(-)-1,2-Diaminocyclohexane
Chiral building block for pharmaceuticals
1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexane-1,2-diamine
SSJXIUAHEKJCMH-MBXGXEIXSA-N
[2H]C1(C(C(C(C(C1([2H])[2H])([2H])N)([2H])N)([2H])[2H])([2H])[2H])[2H]
1,2-Cyclohexane-d10-diamine (cis/trans mixture) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.