This compound is a pharmaceutical intermediate used in the synthesis of efavirenz, a non-nucleoside reverse transcriptase inhibitor. It is characterized by the presence of an aromatic ring, an alcohol group, and a carbamate ester moiety.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 211563-41-6
3-(Trifluoromethyl)benzenepropanal
pharmaceutical intermediate
Abiraterone Impurity N1
Abiraterone intermediate impurity
6-bromopyridine-2-carboxylic acid
pharmaceutical intermediate
Ethyl 6-bromopicolinate
pharmaceutical intermediate
Efavirenz aminoalcohol
Efavirenz intermediate
ethyl N-[4-chloro-2-[(2S)-4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl]phenyl]carbamate
BZIKLWWRUOKZMC-HNNXBMFYSA-N
CCOC(=O)NC1=C(C=C(C=C1)Cl)[C@@](C#CC2CC2)(C(F)(F)F)O