This compound is a research reagent featuring a complex molecular structure with multiple amide and ether linkages, along with a maleimide group and a nitrophenyl carbonate moiety. Its design supports conjugation applications in biochemical research due to the presence of reactive functional groups.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2112738-09-5
L-Ornithinamide, N-[[2-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]ethoxy]carbonyl]-L-valyl-N5-(aminocarbonyl)-N-[4-[[[(4-nitrophenoxy)carbonyl]oxy]methyl]phenyl]-
ADC linker-payload reagent
MC-Val-Cit-PAB-PNP
antibody-drug conjugate linker reagent
3-BROMOBIPHENYL
Research chemical intermediate
Amidinothiourea
research compound
N-Nitroso-N-2,3-xylylanthranilic acid
nitrosamine impurity reference standard
Octadecanoic-17,17,18,18,18-d5 acid
Deuterated fatty acid research standard
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate
ZEPYLTPLLQQBNX-IKYOIFQTSA-N
CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)CCOCCOCCOCCOCCN3C(=O)C=CC3=O