Glu-ala is a dipeptide composed of L-glutamic acid and L-alanine. It is primarily used as a research reagent in metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Glu-ala 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-(3,4-Dimethoxyphenyl)propionic acid
Research compound
Fmoc-Arg(Pbf)-Ser(Psi(Me,Me)pro)-OH
protected amino acid building block
2-Nitro-9,9-diphenyl-9H-fluorene
research compound
NSP-AS
chemiluminescent acridinium ester label
(4S)-4-amino-5-[[(1S)-1-carboxyethyl]amino]-5-oxopentanoic acid
JZDHUJAFXGNDSB-WHFBIAKZSA-N
C[C@@H](C(=O)O)NC(=O)[C@H](CCC(=O)O)N
Glu-ala 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.