o-Oxanisidide, also known as This compound, is a chemical compound featuring two amide groups and two aromatic rings with ether substituents. It is primarily used as a laboratory research reagent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
O-Oxanisidide 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Hydroxy-4-methoxypyridine-2-carboxylic acid
research compound
4-Bromospiro[9H-fluorene-9,5'-[5H]indeno[1,2-b]pyridine]
Research compound for organic electronics
1-Chloro-1H-1,2,4-triazole
research compound
Z-IETD-fmk
caspase-8 inhibitor research compound
Ethanediamide, N-(2-ethoxyphenyl)-N'-(2-ethylphenyl)-
UV stabilizer for plastics
N,N'-bis(2-methoxyphenyl)oxamide
GPOWVQMIFHWEGC-UHFFFAOYSA-N
COC1=CC=CC=C1NC(=O)C(=O)NC2=CC=CC=C2OC
O-Oxanisidide 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.