This compound is a PEG-based conjugation reagent featuring an N-hydroxysuccinimide (NHS) ester group and a protected amine functionality. It is commonly used in bioconjugation chemistry for the attachment of molecules to primary amines under mild conditions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
NHPI-PEG2-C2-NHS ester 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ald-Ph-amido-PEG2-C2-Pfp ester
research reagent for bioconjugation
((2,4-dimethylphenyl)diazenyl)(3-methoxyphenyl)methanone
research compound
5-fluoropyridin-3-amine
research compound
2,6-dibromo-3,5-difluoropyridine
Research reagent for organic synthesis
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]propanoate
UXABBPKGOKMLNT-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCOCCOCCON2C(=O)C3=CC=CC=C3C2=O
NHPI-PEG2-C2-NHS ester 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.